C15H32N2 — CID 156713243
N-methylpropan-1-amine;3-methyl-N-propylhepta-1,6-dien-2-amine (PubChem CID 156713243) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is N-methylpropan-1-amine;3-methyl-N-propylhepta-1,6-dien-2-amine.
| Compound Name | N-methylpropan-1-amine;3-methyl-N-propylhepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 156713243 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | N-methylpropan-1-amine;3-methyl-N-propylhepta-1,6-dien-2-amine |
| SMILES | C=CCCC(C)C(=C)NCCC.CCCNC |
| InChI | InChI=1S/C11H21N.C4H11N/c1-5-7-8-10(3)11(4)12-9-6-2;1-3-4-5-2/h5,10,12H,1,4,6-9H2,2-3H3;5H,3-4H2,1-2H3 |
| InChIKey | FACHPSLFWXDCKL-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|