About N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine
N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine (PubChem CID 170027354) has the molecular formula C20H40N2
and a molecular weight of 308.55 g/mol. Its IUPAC name is N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine.
Molecular Properties
| Compound Name | N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine |
| PubChem CID | 170027354 |
| Molecular Formula | C20H40N2 |
| Molecular Weight | 308.55 g/mol |
| Exact Mass | 308.32 |
| IUPAC Name | N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine |
| SMILES | C=CCCCCC(C)C(=C)NCCCCCCCCNCC |
| InChI | InChI=1S/C20H40N2/c1-5-7-8-13-16-19(3)20(4)22-18-15-12-10-9-11-14-17-21-6-2/h5,19,21-22H,1,4,6-18H2,2-3H3 |
| InChIKey | GADMMIKXJLQRGA-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 308.55 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine?
The IUPAC name of N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine (CID 170027354) is N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine.
What is the SMILES notation for N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine?
The canonical SMILES for N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine is C=CCCCCC(C)C(=C)NCCCCCCCCNCC.
What is the InChIKey of N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine?
The InChIKey is GADMMIKXJLQRGA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H40N2/c1-5-7-8-13-16-19(3)20(4)22-18-15-12-10-9-11-14-17-21-6-2/h5,19,21-22H,1,4,6-18H2,2-3H3.
What are the key properties of N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine?
N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine has a molecular weight of 308.55 g/mol, XLogP of 5.42, 17 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N'-(3-methylnona-1,8-dien-2-yl)octane-1,8-diamine is sourced from PubChem (CID 170027354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).