C20H38FN — CID 174252655
2-fluoro-3,11-dimethyl-N-(3-methylbut-1-en-2-yl)-10-methylidenedodecan-1-amine (PubChem CID 174252655) has the molecular formula C20H38FN and a molecular weight of 311.53 g/mol. Its IUPAC name is 2-fluoro-3,11-dimethyl-N-(3-methylbut-1-en-2-yl)-10-methylidenedodecan-1-amine.
| Compound Name | 2-fluoro-3,11-dimethyl-N-(3-methylbut-1-en-2-yl)-10-methylidenedodecan-1-amine |
|---|---|
| PubChem CID | 174252655 |
| Molecular Formula | C20H38FN |
| Molecular Weight | 311.53 g/mol |
| Exact Mass | 311.30 |
| IUPAC Name | 2-fluoro-3,11-dimethyl-N-(3-methylbut-1-en-2-yl)-10-methylidenedodecan-1-amine |
| SMILES | C=C(CCCCCCC(C)C(F)CNC(=C)C(C)C)C(C)C |
| InChI | InChI=1S/C20H38FN/c1-15(2)17(5)12-10-8-9-11-13-18(6)20(21)14-22-19(7)16(3)4/h15-16,18,20,22H,5,7-14H2,1-4,6H3 |
| InChIKey | SAEZBUAGJIQWOK-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.53 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|