C10H17F — CID 139323815
(6Z)-5-fluoro-6-methylnona-1,6-diene (PubChem CID 139323815) has the molecular formula C10H17F and a molecular weight of 156.24 g/mol. Its IUPAC name is (6Z)-5-fluoro-6-methylnona-1,6-diene.
| Compound Name | (6Z)-5-fluoro-6-methylnona-1,6-diene |
|---|---|
| PubChem CID | 139323815 |
| Molecular Formula | C10H17F |
| Molecular Weight | 156.24 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | (6Z)-5-fluoro-6-methylnona-1,6-diene |
| SMILES | C=CCCC(F)/C(C)=C\CC |
| InChI | InChI=1S/C10H17F/c1-4-6-8-10(11)9(3)7-5-2/h4,7,10H,1,5-6,8H2,2-3H3/b9-7- |
| InChIKey | WXDCHCJGQGJPQT-CLFYSBASSA-N |
| XLogP | 3.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.24 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|