C10H14F2 — CID 142857696
(6Z)-2,5-difluoro-6-methylnona-1,3,6-triene (PubChem CID 142857696) has the molecular formula C10H14F2 and a molecular weight of 172.22 g/mol. Its IUPAC name is (6Z)-2,5-difluoro-6-methylnona-1,3,6-triene.
| Compound Name | (6Z)-2,5-difluoro-6-methylnona-1,3,6-triene |
|---|---|
| PubChem CID | 142857696 |
| Molecular Formula | C10H14F2 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | (6Z)-2,5-difluoro-6-methylnona-1,3,6-triene |
| SMILES | C=C(F)C=CC(F)/C(C)=C\CC |
| InChI | InChI=1S/C10H14F2/c1-4-5-8(2)10(12)7-6-9(3)11/h5-7,10H,3-4H2,1-2H3/b7-6?,8-5- |
| InChIKey | CHEVKYDHWRRWPY-GLMYLDSSSA-N |
| XLogP | 3.72 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|