C7H14F2 — CID 54149650
1,1-difluorobut-1-ene;propane (PubChem CID 54149650) has the molecular formula C7H14F2 and a molecular weight of 136.19 g/mol. Its IUPAC name is 1,1-difluorobut-1-ene;propane.
| Compound Name | 1,1-difluorobut-1-ene;propane |
|---|---|
| PubChem CID | 54149650 |
| Molecular Formula | C7H14F2 |
| Molecular Weight | 136.19 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | 1,1-difluorobut-1-ene;propane |
| SMILES | CCC.CCC=C(F)F |
| InChI | InChI=1S/C4H6F2.C3H8/c1-2-3-4(5)6;1-3-2/h3H,2H2,1H3;3H2,1-2H3 |
| InChIKey | OGVVPBBAUOXTNP-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 136.19 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |