C4H6F2O — CID 14855882
4,4-difluorobut-3-en-1-ol (PubChem CID 14855882) has the molecular formula C4H6F2O and a molecular weight of 108.09 g/mol. Its IUPAC name is 4,4-difluorobut-3-en-1-ol.
| Compound Name | 4,4-difluorobut-3-en-1-ol |
|---|---|
| PubChem CID | 14855882 |
| Molecular Formula | C4H6F2O |
| Molecular Weight | 108.09 g/mol |
| Exact Mass | 108.04 |
| IUPAC Name | 4,4-difluorobut-3-en-1-ol |
| SMILES | OCCC=C(F)F |
| InChI | InChI=1S/C4H6F2O/c5-4(6)2-1-3-7/h2,7H,1,3H2 |
| InChIKey | ZCSILCHJOKWNLB-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 108.09 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |