C7H12F2O — CID 91005146
1,1-difluoro-6-methoxyhex-1-ene (PubChem CID 91005146) has the molecular formula C7H12F2O and a molecular weight of 150.17 g/mol. Its IUPAC name is 1,1-difluoro-6-methoxyhex-1-ene.
| Compound Name | 1,1-difluoro-6-methoxyhex-1-ene |
|---|---|
| PubChem CID | 91005146 |
| Molecular Formula | C7H12F2O |
| Molecular Weight | 150.17 g/mol |
| Exact Mass | 150.09 |
| IUPAC Name | 1,1-difluoro-6-methoxyhex-1-ene |
| SMILES | COCCCCC=C(F)F |
| InChI | InChI=1S/C7H12F2O/c1-10-6-4-2-3-5-7(8)9/h5H,2-4,6H2,1H3 |
| InChIKey | DRFHJJFHBVHOBW-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.17 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|