C13H23ClF2O — CID 19915370
(E)-1-chloro-1,1-difluoro-12-methoxydodec-2-ene (PubChem CID 19915370) has the molecular formula C13H23ClF2O and a molecular weight of 268.77 g/mol. Its IUPAC name is (E)-1-chloro-1,1-difluoro-12-methoxydodec-2-ene.
| Compound Name | (E)-1-chloro-1,1-difluoro-12-methoxydodec-2-ene |
|---|---|
| PubChem CID | 19915370 |
| Molecular Formula | C13H23ClF2O |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.14 |
| IUPAC Name | (E)-1-chloro-1,1-difluoro-12-methoxydodec-2-ene |
| SMILES | COCCCCCCCCC/C=C/C(F)(F)Cl |
| InChI | InChI=1S/C13H23ClF2O/c1-17-12-10-8-6-4-2-3-5-7-9-11-13(14,15)16/h9,11H,2-8,10,12H2,1H3/b11-9+ |
| InChIKey | LOMBOBIBPKPMQR-PKNBQFBNSA-N |
| XLogP | 5.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|