C21H37O4P — CID 90787861
20-methoxyicosa-5,8,11,14-tetraenylphosphonic acid (PubChem CID 90787861) has the molecular formula C21H37O4P and a molecular weight of 384.50 g/mol. Its IUPAC name is 20-methoxyicosa-5,8,11,14-tetraenylphosphonic acid.
| Compound Name | 20-methoxyicosa-5,8,11,14-tetraenylphosphonic acid |
|---|---|
| PubChem CID | 90787861 |
| Molecular Formula | C21H37O4P |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.24 |
| IUPAC Name | 20-methoxyicosa-5,8,11,14-tetraenylphosphonic acid |
| SMILES | COCCCCCC=CCC=CCC=CCC=CCCCCP(=O)(O)O |
| InChI | InChI=1S/C21H37O4P/c1-25-20-18-16-14-12-10-8-6-4-2-3-5-7-9-11-13-15-17-19-21-26(22,23)24/h2,4-5,7-8,10-11,13H,3,6,9,12,14-21H2,1H3,(H2,22,23,24) |
| InChIKey | ZMGOSOUNSHYDHW-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|