C18H30O2 — CID 143822214
ethane;1-methoxy-2-[(E)-7-methoxyhept-1-enyl]-4-methylbenzene (PubChem CID 143822214) has the molecular formula C18H30O2 and a molecular weight of 278.44 g/mol. Its IUPAC name is ethane;1-methoxy-2-[(E)-7-methoxyhept-1-enyl]-4-methylbenzene.
| Compound Name | ethane;1-methoxy-2-[(E)-7-methoxyhept-1-enyl]-4-methylbenzene |
|---|---|
| PubChem CID | 143822214 |
| Molecular Formula | C18H30O2 |
| Molecular Weight | 278.44 g/mol |
| Exact Mass | 278.22 |
| IUPAC Name | ethane;1-methoxy-2-[(E)-7-methoxyhept-1-enyl]-4-methylbenzene |
| SMILES | CC.COCCCCC/C=C/c1cc(C)ccc1OC |
| InChI | InChI=1S/C16H24O2.C2H6/c1-14-10-11-16(18-3)15(13-14)9-7-5-4-6-8-12-17-2;1-2/h7,9-11,13H,4-6,8,12H2,1-3H3;1-2H3/b9-7+; |
| InChIKey | MDAAOXAYBKPEQW-BXTVWIJMSA-N |
| XLogP | 5.25 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.44 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|