C17H28O2 — CID 143867312
ethane;(E)-7-(2-methoxy-5-methylphenyl)hept-6-en-2-ol (PubChem CID 143867312) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is ethane;(E)-7-(2-methoxy-5-methylphenyl)hept-6-en-2-ol.
| Compound Name | ethane;(E)-7-(2-methoxy-5-methylphenyl)hept-6-en-2-ol |
|---|---|
| PubChem CID | 143867312 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | ethane;(E)-7-(2-methoxy-5-methylphenyl)hept-6-en-2-ol |
| SMILES | CC.COc1ccc(C)cc1/C=C/CCCC(C)O |
| InChI | InChI=1S/C15H22O2.C2H6/c1-12-9-10-15(17-3)14(11-12)8-6-4-5-7-13(2)16;1-2/h6,8-11,13,16H,4-5,7H2,1-3H3;1-2H3/b8-6+; |
| InChIKey | CKAAMLXZKJDEHQ-WVLIHFOGSA-N |
| XLogP | 4.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|