C12H16O2 — CID 143867297
(E)-4-(2-methoxy-5-methylphenyl)but-3-en-1-ol (PubChem CID 143867297) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is (E)-4-(2-methoxy-5-methylphenyl)but-3-en-1-ol.
| Compound Name | (E)-4-(2-methoxy-5-methylphenyl)but-3-en-1-ol |
|---|---|
| PubChem CID | 143867297 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | (E)-4-(2-methoxy-5-methylphenyl)but-3-en-1-ol |
| SMILES | COc1ccc(C)cc1/C=C/CCO |
| InChI | InChI=1S/C12H16O2/c1-10-6-7-12(14-2)11(9-10)5-3-4-8-13/h3,5-7,9,13H,4,8H2,1-2H3/b5-3+ |
| InChIKey | LJERYYHRJBNTJU-HWKANZROSA-N |
| XLogP | 2.40 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |