C19H32O2 — CID 143822201
ethane;(E)-8-(2-methoxy-5-methylphenyl)-2-methyloct-7-en-2-ol (PubChem CID 143822201) has the molecular formula C19H32O2 and a molecular weight of 292.46 g/mol. Its IUPAC name is ethane;(E)-8-(2-methoxy-5-methylphenyl)-2-methyloct-7-en-2-ol.
| Compound Name | ethane;(E)-8-(2-methoxy-5-methylphenyl)-2-methyloct-7-en-2-ol |
|---|---|
| PubChem CID | 143822201 |
| Molecular Formula | C19H32O2 |
| Molecular Weight | 292.46 g/mol |
| Exact Mass | 292.24 |
| IUPAC Name | ethane;(E)-8-(2-methoxy-5-methylphenyl)-2-methyloct-7-en-2-ol |
| SMILES | CC.COc1ccc(C)cc1/C=C/CCCCC(C)(C)O |
| InChI | InChI=1S/C17H26O2.C2H6/c1-14-10-11-16(19-4)15(13-14)9-7-5-6-8-12-17(2,3)18;1-2/h7,9-11,13,18H,5-6,8,12H2,1-4H3;1-2H3/b9-7+; |
| InChIKey | SHDKRKOVRJTVJA-BXTVWIJMSA-N |
| XLogP | 5.37 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.46 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|