C16H26O3 — CID 165345524
2-(2-methoxy-5-methylphenyl)-6-methylheptane-2,6-diol (PubChem CID 165345524) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is 2-(2-methoxy-5-methylphenyl)-6-methylheptane-2,6-diol.
| Compound Name | 2-(2-methoxy-5-methylphenyl)-6-methylheptane-2,6-diol |
|---|---|
| PubChem CID | 165345524 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | 2-(2-methoxy-5-methylphenyl)-6-methylheptane-2,6-diol |
| SMILES | COc1ccc(C)cc1C(C)(O)CCCC(C)(C)O |
| InChI | InChI=1S/C16H26O3/c1-12-7-8-14(19-5)13(11-12)16(4,18)10-6-9-15(2,3)17/h7-8,11,17-18H,6,9-10H2,1-5H3 |
| InChIKey | SEERSAUKSYYOOQ-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |