C12H15FO4 — CID 79366441
2-fluoro-3-hydroxy-3-(2-methoxy-5-methylphenyl)butanoic acid (PubChem CID 79366441) has the molecular formula C12H15FO4 and a molecular weight of 242.25 g/mol. Its IUPAC name is 2-fluoro-3-hydroxy-3-(2-methoxy-5-methylphenyl)butanoic acid.
| Compound Name | 2-fluoro-3-hydroxy-3-(2-methoxy-5-methylphenyl)butanoic acid |
|---|---|
| PubChem CID | 79366441 |
| Molecular Formula | C12H15FO4 |
| Molecular Weight | 242.25 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 2-fluoro-3-hydroxy-3-(2-methoxy-5-methylphenyl)butanoic acid |
| SMILES | COc1ccc(C)cc1C(C)(O)C(F)C(=O)O |
| InChI | InChI=1S/C12H15FO4/c1-7-4-5-9(17-3)8(6-7)12(2,16)10(13)11(14)15/h4-6,10,16H,1-3H3,(H,14,15) |
| InChIKey | ZXYYXFYQYCVXIC-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.25 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |