C18H24Cl2F2O — CID 19915353
1-chloro-4-[(E)-12-chloro-12,12-difluorododec-10-enoxy]benzene (PubChem CID 19915353) has the molecular formula C18H24Cl2F2O and a molecular weight of 365.29 g/mol. Its IUPAC name is 1-chloro-4-[(E)-12-chloro-12,12-difluorododec-10-enoxy]benzene.
| Compound Name | 1-chloro-4-[(E)-12-chloro-12,12-difluorododec-10-enoxy]benzene |
|---|---|
| PubChem CID | 19915353 |
| Molecular Formula | C18H24Cl2F2O |
| Molecular Weight | 365.29 g/mol |
| Exact Mass | 364.12 |
| IUPAC Name | 1-chloro-4-[(E)-12-chloro-12,12-difluorododec-10-enoxy]benzene |
| SMILES | FC(F)(Cl)/C=C/CCCCCCCCCOc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H24Cl2F2O/c19-16-10-12-17(13-11-16)23-15-9-7-5-3-1-2-4-6-8-14-18(20,21)22/h8,10-14H,1-7,9,15H2/b14-8+ |
| InChIKey | CQTUUEZOYAEENN-RIYZIHGNSA-N |
| XLogP | 7.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.29 |
| LogP ≤ 5 | 7.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|