C13H22O3 — CID 138511621
(3Z,5E)-3,4,10-trimethoxydeca-1,3,5-triene (PubChem CID 138511621) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is (3Z,5E)-3,4,10-trimethoxydeca-1,3,5-triene.
| Compound Name | (3Z,5E)-3,4,10-trimethoxydeca-1,3,5-triene |
|---|---|
| PubChem CID | 138511621 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | (3Z,5E)-3,4,10-trimethoxydeca-1,3,5-triene |
| SMILES | C=C/C(OC)=C(\C=C\CCCCOC)OC |
| InChI | InChI=1S/C13H22O3/c1-5-12(15-3)13(16-4)10-8-6-7-9-11-14-2/h5,8,10H,1,6-7,9,11H2,2-4H3/b10-8+,13-12- |
| InChIKey | QPVMZZDWMLUWGT-SMEYHRCOSA-N |
| XLogP | 3.05 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|