C7H14O2 — CID 129322397
(Z)-3-methylhex-3-ene-1,6-diol (PubChem CID 129322397) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is (Z)-3-methylhex-3-ene-1,6-diol.
| Compound Name | (Z)-3-methylhex-3-ene-1,6-diol |
|---|---|
| PubChem CID | 129322397 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | (Z)-3-methylhex-3-ene-1,6-diol |
| SMILES | C/C(=C/CCO)CCO |
| InChI | InChI=1S/C7H14O2/c1-7(4-6-9)3-2-5-8/h3,8-9H,2,4-6H2,1H3/b7-3- |
| InChIKey | VILWHBHXQVYUEE-CLTKARDFSA-N |
| XLogP | 0.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|