About 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol
6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol (PubChem CID 21326788) has the molecular formula C15H31ClO2
and a molecular weight of 278.86 g/mol. Its IUPAC name is 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol.
Molecular Properties
| Compound Name | 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol |
| PubChem CID | 21326788 |
| Molecular Formula | C15H31ClO2 |
| Molecular Weight | 278.86 g/mol |
| Exact Mass | 278.20 |
| IUPAC Name | 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol |
| SMILES | CCCC/C=C(/C)CCO.OCCCCCCCl |
| InChI | InChI=1S/C9H18O.C6H13ClO/c1-3-4-5-6-9(2)7-8-10;7-5-3-1-2-4-6-8/h6,10H,3-5,7-8H2,1-2H3;8H,1-6H2/b9-6-; |
| InChIKey | WYQSUYVFCXJNPU-BORNJIKYSA-N |
| XLogP | 4.28 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.86 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol?
The IUPAC name of 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol (CID 21326788) is 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol.
What is the SMILES notation for 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol?
The canonical SMILES for 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol is CCCC/C=C(/C)CCO.OCCCCCCCl.
What is the InChIKey of 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol?
The InChIKey is WYQSUYVFCXJNPU-BORNJIKYSA-N. The full InChI is InChI=1S/C9H18O.C6H13ClO/c1-3-4-5-6-9(2)7-8-10;7-5-3-1-2-4-6-8/h6,10H,3-5,7-8H2,1-2H3;8H,1-6H2/b9-6-;.
What are the key properties of 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol?
6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol has a molecular weight of 278.86 g/mol, XLogP of 4.28, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chlorohexan-1-ol;(Z)-3-methyloct-3-en-1-ol is sourced from PubChem (CID 21326788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).