C9H11F3 — CID 143818434
acetylene;(2Z,4E)-2,3,4-trifluorohepta-2,4-diene (PubChem CID 143818434) has the molecular formula C9H11F3 and a molecular weight of 176.18 g/mol. Its IUPAC name is acetylene;(2Z,4E)-2,3,4-trifluorohepta-2,4-diene.
| Compound Name | acetylene;(2Z,4E)-2,3,4-trifluorohepta-2,4-diene |
|---|---|
| PubChem CID | 143818434 |
| Molecular Formula | C9H11F3 |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | acetylene;(2Z,4E)-2,3,4-trifluorohepta-2,4-diene |
| SMILES | C#C.CC/C=C(F)\C(F)=C(/C)F |
| InChI | InChI=1S/C7H9F3.C2H2/c1-3-4-6(9)7(10)5(2)8;1-2/h4H,3H2,1-2H3;1-2H/b6-4+,7-5-; |
| InChIKey | BRYCRSFKXINNOJ-XGGDKXJTSA-N |
| XLogP | 3.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|