C7H9F4N — CID 166104491
(E)-1,1,1,3-tetrafluoro-N-methylhex-3-en-2-imine (PubChem CID 166104491) has the molecular formula C7H9F4N and a molecular weight of 183.15 g/mol. Its IUPAC name is (E)-1,1,1,3-tetrafluoro-N-methylhex-3-en-2-imine.
| Compound Name | (E)-1,1,1,3-tetrafluoro-N-methylhex-3-en-2-imine |
|---|---|
| PubChem CID | 166104491 |
| Molecular Formula | C7H9F4N |
| Molecular Weight | 183.15 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | (E)-1,1,1,3-tetrafluoro-N-methylhex-3-en-2-imine |
| SMILES | CC/C=C(F)\C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C7H9F4N/c1-3-4-5(8)6(12-2)7(9,10)11/h4H,3H2,1-2H3/b5-4+,12-6+ |
| InChIKey | SJZCHWLEXYPFNH-ICLXBRQCSA-N |
| XLogP | 2.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.15 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|