C7H10F3NO — CID 166104999
(E)-1,1,1-trifluoro-2-methyliminohex-3-en-3-ol (PubChem CID 166104999) has the molecular formula C7H10F3NO and a molecular weight of 181.16 g/mol. Its IUPAC name is (E)-1,1,1-trifluoro-2-methyliminohex-3-en-3-ol.
| Compound Name | (E)-1,1,1-trifluoro-2-methyliminohex-3-en-3-ol |
|---|---|
| PubChem CID | 166104999 |
| Molecular Formula | C7H10F3NO |
| Molecular Weight | 181.16 g/mol |
| Exact Mass | 181.07 |
| IUPAC Name | (E)-1,1,1-trifluoro-2-methyliminohex-3-en-3-ol |
| SMILES | CC/C=C(O)\C(=N/C)C(F)(F)F |
| InChI | InChI=1S/C7H10F3NO/c1-3-4-5(12)6(11-2)7(8,9)10/h4,12H,3H2,1-2H3/b5-4+,11-6+ |
| InChIKey | LNJLGTQCOJNHCU-LJIKRCSCSA-N |
| XLogP | 2.47 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.16 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|