C10H15F — CID 142928333
acetylene;(2E,4Z)-2-fluoro-3-methylhepta-2,4-diene (PubChem CID 142928333) has the molecular formula C10H15F and a molecular weight of 154.23 g/mol. Its IUPAC name is acetylene;(2E,4Z)-2-fluoro-3-methylhepta-2,4-diene.
| Compound Name | acetylene;(2E,4Z)-2-fluoro-3-methylhepta-2,4-diene |
|---|---|
| PubChem CID | 142928333 |
| Molecular Formula | C10H15F |
| Molecular Weight | 154.23 g/mol |
| Exact Mass | 154.12 |
| IUPAC Name | acetylene;(2E,4Z)-2-fluoro-3-methylhepta-2,4-diene |
| SMILES | C#C.CC/C=C\C(C)=C(/C)F |
| InChI | InChI=1S/C8H13F.C2H2/c1-4-5-6-7(2)8(3)9;1-2/h5-6H,4H2,1-3H3;1-2H/b6-5-,8-7+; |
| InChIKey | VIGJAMKWEVAPIQ-DUZKJZLISA-N |
| XLogP | 3.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.23 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|