C10H16F2 — CID 167105692
(3Z,5E)-6,7-difluoro-5-methylnona-3,5-diene (PubChem CID 167105692) has the molecular formula C10H16F2 and a molecular weight of 174.23 g/mol. Its IUPAC name is (3Z,5E)-6,7-difluoro-5-methylnona-3,5-diene.
| Compound Name | (3Z,5E)-6,7-difluoro-5-methylnona-3,5-diene |
|---|---|
| PubChem CID | 167105692 |
| Molecular Formula | C10H16F2 |
| Molecular Weight | 174.23 g/mol |
| Exact Mass | 174.12 |
| IUPAC Name | (3Z,5E)-6,7-difluoro-5-methylnona-3,5-diene |
| SMILES | CC/C=C\C(C)=C(\F)C(F)CC |
| InChI | InChI=1S/C10H16F2/c1-4-6-7-8(3)10(12)9(11)5-2/h6-7,9H,4-5H2,1-3H3/b7-6-,10-8+ |
| InChIKey | KIVNIVAHMCZZMO-VAAURPRASA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.23 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|