C9H16FN — CID 129209760
(Z,2E)-2-(2-fluoropropylidene)hex-3-en-1-amine (PubChem CID 129209760) has the molecular formula C9H16FN and a molecular weight of 157.23 g/mol. Its IUPAC name is (Z,2E)-2-(2-fluoropropylidene)hex-3-en-1-amine.
| Compound Name | (Z,2E)-2-(2-fluoropropylidene)hex-3-en-1-amine |
|---|---|
| PubChem CID | 129209760 |
| Molecular Formula | C9H16FN |
| Molecular Weight | 157.23 g/mol |
| Exact Mass | 157.13 |
| IUPAC Name | (Z,2E)-2-(2-fluoropropylidene)hex-3-en-1-amine |
| SMILES | CC/C=C\C(=C/C(C)F)CN |
| InChI | InChI=1S/C9H16FN/c1-3-4-5-9(7-11)6-8(2)10/h4-6,8H,3,7,11H2,1-2H3/b5-4-,9-6+ |
| InChIKey | XYLWWCSNNKGTKL-KMOPYBJPSA-N |
| XLogP | 2.20 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.23 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|