C18H29N — CID 167133024
(3Z,6Z,8Z,10Z,13Z)-8-ethylidenehexadeca-3,6,10,13-tetraen-1-amine (PubChem CID 167133024) has the molecular formula C18H29N and a molecular weight of 259.44 g/mol. Its IUPAC name is (3Z,6Z,8Z,10Z,13Z)-8-ethylidenehexadeca-3,6,10,13-tetraen-1-amine.
| Compound Name | (3Z,6Z,8Z,10Z,13Z)-8-ethylidenehexadeca-3,6,10,13-tetraen-1-amine |
|---|---|
| PubChem CID | 167133024 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | (3Z,6Z,8Z,10Z,13Z)-8-ethylidenehexadeca-3,6,10,13-tetraen-1-amine |
| SMILES | C/C=C(\C=C/C/C=C\CCN)C/C=C\C/C=C\CC |
| InChI | InChI=1S/C18H29N/c1-3-5-6-7-9-12-15-18(4-2)16-13-10-8-11-14-17-19/h4-6,8-9,11-13,16H,3,7,10,14-15,17,19H2,1-2H3/b6-5-,11-8-,12-9-,16-13-,18-4- |
| InChIKey | GWFJIGYWWNFKLM-QALKZGOBSA-N |
| XLogP | 5.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|