About (2E,4E)-3-ethylhepta-2,4-diene
(2E,4E)-3-ethylhepta-2,4-diene (PubChem CID 19878662) has the molecular formula C9H16
and a molecular weight of 124.23 g/mol. Its IUPAC name is (2E,4E)-3-ethylhepta-2,4-diene.
Molecular Properties
| Compound Name | (2E,4E)-3-ethylhepta-2,4-diene |
| PubChem CID | 19878662 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (2E,4E)-3-ethylhepta-2,4-diene |
| SMILES | C/C=C(/C=C/CC)CC |
| InChI | InChI=1S/C9H16/c1-4-7-8-9(5-2)6-3/h5,7-8H,4,6H2,1-3H3/b8-7+,9-5+ |
| InChIKey | XGAWMSJRPQPWSR-DMQCZMPNSA-N |
| XLogP | 3.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4E)-3-ethylhepta-2,4-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4E)-3-ethylhepta-2,4-diene?
The IUPAC name of (2E,4E)-3-ethylhepta-2,4-diene (CID 19878662) is (2E,4E)-3-ethylhepta-2,4-diene.
What is the SMILES notation for (2E,4E)-3-ethylhepta-2,4-diene?
The canonical SMILES for (2E,4E)-3-ethylhepta-2,4-diene is C/C=C(/C=C/CC)CC.
What is the InChIKey of (2E,4E)-3-ethylhepta-2,4-diene?
The InChIKey is XGAWMSJRPQPWSR-DMQCZMPNSA-N. The full InChI is InChI=1S/C9H16/c1-4-7-8-9(5-2)6-3/h5,7-8H,4,6H2,1-3H3/b8-7+,9-5+.
What are the key properties of (2E,4E)-3-ethylhepta-2,4-diene?
(2E,4E)-3-ethylhepta-2,4-diene has a molecular weight of 124.23 g/mol, XLogP of 3.31, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4E)-3-ethylhepta-2,4-diene is sourced from PubChem (CID 19878662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).