C15H22 — CID 144556498
(3Z,6Z,7Z)-6-ethylidene-4-[(Z)-prop-1-enyl]deca-1,3,7-triene (PubChem CID 144556498) has the molecular formula C15H22 and a molecular weight of 202.34 g/mol. Its IUPAC name is (3Z,6Z,7Z)-6-ethylidene-4-[(Z)-prop-1-enyl]deca-1,3,7-triene.
| Compound Name | (3Z,6Z,7Z)-6-ethylidene-4-[(Z)-prop-1-enyl]deca-1,3,7-triene |
|---|---|
| PubChem CID | 144556498 |
| Molecular Formula | C15H22 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | (3Z,6Z,7Z)-6-ethylidene-4-[(Z)-prop-1-enyl]deca-1,3,7-triene |
| SMILES | C=C/C=C(\C=C/C)CC(/C=C\CC)=C/C |
| InChI | InChI=1S/C15H22/c1-5-9-12-14(8-4)13-15(10-6-2)11-7-3/h6-12H,2,5,13H2,1,3-4H3/b11-7-,12-9-,14-8+,15-10+ |
| InChIKey | GBKMRJKWFCFMQI-OUOXDEABSA-N |
| XLogP | 4.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|