C12H21NO — CID 143653650
2-[[(Z,3Z)-3-prop-2-enylidenehept-4-enyl]amino]ethanol (PubChem CID 143653650) has the molecular formula C12H21NO and a molecular weight of 195.31 g/mol. Its IUPAC name is 2-[[(Z,3Z)-3-prop-2-enylidenehept-4-enyl]amino]ethanol.
| Compound Name | 2-[[(Z,3Z)-3-prop-2-enylidenehept-4-enyl]amino]ethanol |
|---|---|
| PubChem CID | 143653650 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 2-[[(Z,3Z)-3-prop-2-enylidenehept-4-enyl]amino]ethanol |
| SMILES | C=C/C=C(\C=C/CC)CCNCCO |
| InChI | InChI=1S/C12H21NO/c1-3-5-7-12(6-4-2)8-9-13-10-11-14/h4-7,13-14H,2-3,8-11H2,1H3/b7-5-,12-6+ |
| InChIKey | DNDSMTPHICNBBI-NFWBANDSSA-N |
| XLogP | 2.04 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|