C11H18O2 — CID 142164581
3-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxypropan-1-ol (PubChem CID 142164581) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 3-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxypropan-1-ol.
| Compound Name | 3-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxypropan-1-ol |
|---|---|
| PubChem CID | 142164581 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 3-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxypropan-1-ol |
| SMILES | C=C/C=C(\C=C/CC)OCCCO |
| InChI | InChI=1S/C11H18O2/c1-3-5-8-11(7-4-2)13-10-6-9-12/h4-5,7-8,12H,2-3,6,9-10H2,1H3/b8-5-,11-7+ |
| InChIKey | GRFVIGAPCLVBKB-NDYCNEGQSA-N |
| XLogP | 2.42 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|