C25H46O — CID 142260212
1-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxyheptadecane (PubChem CID 142260212) has the molecular formula C25H46O and a molecular weight of 362.64 g/mol. Its IUPAC name is 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxyheptadecane.
| Compound Name | 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxyheptadecane |
|---|---|
| PubChem CID | 142260212 |
| Molecular Formula | C25H46O |
| Molecular Weight | 362.64 g/mol |
| Exact Mass | 362.35 |
| IUPAC Name | 1-[(3E,5Z)-octa-1,3,5-trien-4-yl]oxyheptadecane |
| SMILES | C=C/C=C(\C=C/CC)OCCCCCCCCCCCCCCCCC |
| InChI | InChI=1S/C25H46O/c1-4-7-9-10-11-12-13-14-15-16-17-18-19-20-21-24-26-25(22-6-3)23-8-5-2/h6,8,22-23H,3-5,7,9-21,24H2,1-2H3/b23-8-,25-22+ |
| InChIKey | WNPBISGGIVWHKP-KFYZKCJSSA-N |
| XLogP | 8.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.64 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|