C27H39NO — CID 170007265
[2-methyl-5-[(4Z,6E)-2-methylidene-6-nonoxynona-4,6,8-trienyl]phenyl]methanimine (PubChem CID 170007265) has the molecular formula C27H39NO and a molecular weight of 393.62 g/mol. Its IUPAC name is [2-methyl-5-[(4Z,6E)-2-methylidene-6-nonoxynona-4,6,8-trienyl]phenyl]methanimine.
| Compound Name | [2-methyl-5-[(4Z,6E)-2-methylidene-6-nonoxynona-4,6,8-trienyl]phenyl]methanimine |
|---|---|
| PubChem CID | 170007265 |
| Molecular Formula | C27H39NO |
| Molecular Weight | 393.62 g/mol |
| Exact Mass | 393.30 |
| IUPAC Name | [2-methyl-5-[(4Z,6E)-2-methylidene-6-nonoxynona-4,6,8-trienyl]phenyl]methanimine |
| SMILES | [H]/N=C/c1cc(CC(=C)C/C=C\C(=C/C=C)OCCCCCCCCC)ccc1C |
| InChI | InChI=1S/C27H39NO/c1-5-7-8-9-10-11-12-19-29-27(14-6-2)16-13-15-23(3)20-25-18-17-24(4)26(21-25)22-28/h6,13-14,16-18,21-22,28H,2-3,5,7-12,15,19-20H2,1,4H3/b16-13-,27-14+,28-22+ |
| InChIKey | QVHYPTDLZASBEZ-LOZHOZMJSA-N |
| XLogP | 7.87 |
| TPSA | 33.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.62 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|