C20H35NO3 — CID 123661700
10-(1-hydroxynona-2,4,6-trien-5-yloxy)-N-methyldecanamide (PubChem CID 123661700) has the molecular formula C20H35NO3 and a molecular weight of 337.50 g/mol. Its IUPAC name is 10-(1-hydroxynona-2,4,6-trien-5-yloxy)-N-methyldecanamide.
| Compound Name | 10-(1-hydroxynona-2,4,6-trien-5-yloxy)-N-methyldecanamide |
|---|---|
| PubChem CID | 123661700 |
| Molecular Formula | C20H35NO3 |
| Molecular Weight | 337.50 g/mol |
| Exact Mass | 337.26 |
| IUPAC Name | 10-(1-hydroxynona-2,4,6-trien-5-yloxy)-N-methyldecanamide |
| SMILES | CCC=CC(=CC=CCO)OCCCCCCCCCC(=O)NC |
| InChI | InChI=1S/C20H35NO3/c1-3-4-14-19(15-11-12-17-22)24-18-13-9-7-5-6-8-10-16-20(23)21-2/h4,11-12,14-15,22H,3,5-10,13,16-18H2,1-2H3,(H,21,23) |
| InChIKey | KLKBEQAIMRNDGB-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.50 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|