About CID 59445332
CID 59445332 (PubChem CID 59445332) has the molecular formula C7H15N2O
and a molecular weight of 143.21 g/mol.
Molecular Properties
| Compound Name | CID 59445332 |
| PubChem CID | 59445332 |
| Molecular Formula | C7H15N2O |
| Molecular Weight | 143.21 g/mol |
| Exact Mass | 143.12 |
| IUPAC Name | — |
| SMILES | CNC(=O)CCCCC[NH] |
| InChI | InChI=1S/C7H15N2O/c1-9-7(10)5-3-2-4-6-8/h8H,2-6H2,1H3,(H,9,10) |
| InChIKey | JGQSXHAQTLHFJJ-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 52.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.21 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze CID 59445332 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 59445332?
The IUPAC name of CID 59445332 (CID 59445332) is not available.
What is the SMILES notation for CID 59445332?
The canonical SMILES for CID 59445332 is CNC(=O)CCCCC[NH].
What is the InChIKey of CID 59445332?
The InChIKey is JGQSXHAQTLHFJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15N2O/c1-9-7(10)5-3-2-4-6-8/h8H,2-6H2,1H3,(H,9,10).
What are the key properties of CID 59445332?
CID 59445332 has a molecular weight of 143.21 g/mol, XLogP of 0.58, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 59445332 is sourced from PubChem (CID 59445332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).