About N-methyl-N'-sulfanylnonanediamide
N-methyl-N'-sulfanylnonanediamide (PubChem CID 143363504) has the molecular formula C10H20N2O2S
and a molecular weight of 232.35 g/mol. Its IUPAC name is N-methyl-N'-sulfanylnonanediamide.
Molecular Properties
| Compound Name | N-methyl-N'-sulfanylnonanediamide |
| PubChem CID | 143363504 |
| Molecular Formula | C10H20N2O2S |
| Molecular Weight | 232.35 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | N-methyl-N'-sulfanylnonanediamide |
| SMILES | CNC(=O)CCCCCCCC(=O)NS |
| InChI | InChI=1S/C10H20N2O2S/c1-11-9(13)7-5-3-2-4-6-8-10(14)12-15/h15H,2-8H2,1H3,(H,11,13)(H,12,14) |
| InChIKey | QNEZEOQMLPWCLT-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.35 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N'-sulfanylnonanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N'-sulfanylnonanediamide?
The IUPAC name of N-methyl-N'-sulfanylnonanediamide (CID 143363504) is N-methyl-N'-sulfanylnonanediamide.
What is the SMILES notation for N-methyl-N'-sulfanylnonanediamide?
The canonical SMILES for N-methyl-N'-sulfanylnonanediamide is CNC(=O)CCCCCCCC(=O)NS.
What is the InChIKey of N-methyl-N'-sulfanylnonanediamide?
The InChIKey is QNEZEOQMLPWCLT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H20N2O2S/c1-11-9(13)7-5-3-2-4-6-8-10(14)12-15/h15H,2-8H2,1H3,(H,11,13)(H,12,14).
What are the key properties of N-methyl-N'-sulfanylnonanediamide?
N-methyl-N'-sulfanylnonanediamide has a molecular weight of 232.35 g/mol, XLogP of 1.42, 8 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N'-sulfanylnonanediamide is sourced from PubChem (CID 143363504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).