About N-sulfanylundecanamide
N-sulfanylundecanamide (PubChem CID 122641714) has the molecular formula C11H23NOS
and a molecular weight of 217.38 g/mol. Its IUPAC name is N-sulfanylundecanamide.
Molecular Properties
| Compound Name | N-sulfanylundecanamide |
| PubChem CID | 122641714 |
| Molecular Formula | C11H23NOS |
| Molecular Weight | 217.38 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | N-sulfanylundecanamide |
| SMILES | CCCCCCCCCCC(=O)NS |
| InChI | InChI=1S/C11H23NOS/c1-2-3-4-5-6-7-8-9-10-11(13)12-14/h14H,2-10H2,1H3,(H,12,13) |
| InChIKey | BCKDPSZDIQEBRJ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.38 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-sulfanylundecanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-sulfanylundecanamide?
The IUPAC name of N-sulfanylundecanamide (CID 122641714) is N-sulfanylundecanamide.
What is the SMILES notation for N-sulfanylundecanamide?
The canonical SMILES for N-sulfanylundecanamide is CCCCCCCCCCC(=O)NS.
What is the InChIKey of N-sulfanylundecanamide?
The InChIKey is BCKDPSZDIQEBRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NOS/c1-2-3-4-5-6-7-8-9-10-11(13)12-14/h14H,2-10H2,1H3,(H,12,13).
What are the key properties of N-sulfanylundecanamide?
N-sulfanylundecanamide has a molecular weight of 217.38 g/mol, XLogP of 3.48, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-sulfanylundecanamide is sourced from PubChem (CID 122641714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).