About N-sulfanylbutanamide
N-sulfanylbutanamide (PubChem CID 18680505) has the molecular formula C4H9NOS
and a molecular weight of 119.19 g/mol. Its IUPAC name is N-sulfanylbutanamide.
Molecular Properties
| Compound Name | N-sulfanylbutanamide |
| PubChem CID | 18680505 |
| Molecular Formula | C4H9NOS |
| Molecular Weight | 119.19 g/mol |
| Exact Mass | 119.04 |
| IUPAC Name | N-sulfanylbutanamide |
| SMILES | CCCC(=O)NS |
| InChI | InChI=1S/C4H9NOS/c1-2-3-4(6)5-7/h7H,2-3H2,1H3,(H,5,6) |
| InChIKey | FIXOTSFGKSTPFN-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.19 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze N-sulfanylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-sulfanylbutanamide?
The IUPAC name of N-sulfanylbutanamide (CID 18680505) is N-sulfanylbutanamide.
What is the SMILES notation for N-sulfanylbutanamide?
The canonical SMILES for N-sulfanylbutanamide is CCCC(=O)NS.
What is the InChIKey of N-sulfanylbutanamide?
The InChIKey is FIXOTSFGKSTPFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NOS/c1-2-3-4(6)5-7/h7H,2-3H2,1H3,(H,5,6).
What are the key properties of N-sulfanylbutanamide?
N-sulfanylbutanamide has a molecular weight of 119.19 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-sulfanylbutanamide is sourced from PubChem (CID 18680505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).