C12H21NO7 — CID 175448112
6-(methylamino)-6-oxohexanoic acid;pentanedioic acid (PubChem CID 175448112) has the molecular formula C12H21NO7 and a molecular weight of 291.30 g/mol. Its IUPAC name is 6-(methylamino)-6-oxohexanoic acid;pentanedioic acid.
| Compound Name | 6-(methylamino)-6-oxohexanoic acid;pentanedioic acid |
|---|---|
| PubChem CID | 175448112 |
| Molecular Formula | C12H21NO7 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.13 |
| IUPAC Name | 6-(methylamino)-6-oxohexanoic acid;pentanedioic acid |
| SMILES | CNC(=O)CCCCC(=O)O.O=C(O)CCCC(=O)O |
| InChI | InChI=1S/C7H13NO3.C5H8O4/c1-8-6(9)4-2-3-5-7(10)11;6-4(7)2-1-3-5(8)9/h2-5H2,1H3,(H,8,9)(H,10,11);1-3H2,(H,6,7)(H,8,9) |
| InChIKey | DBRCDYAMHGDWIY-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 141.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|