C7H11NO4 — CID 123522335
6-(methylamino)-2,6-dioxohexanoic acid (PubChem CID 123522335) has the molecular formula C7H11NO4 and a molecular weight of 173.17 g/mol. Its IUPAC name is 6-(methylamino)-2,6-dioxohexanoic acid.
| Compound Name | 6-(methylamino)-2,6-dioxohexanoic acid |
|---|---|
| PubChem CID | 123522335 |
| Molecular Formula | C7H11NO4 |
| Molecular Weight | 173.17 g/mol |
| Exact Mass | 173.07 |
| IUPAC Name | 6-(methylamino)-2,6-dioxohexanoic acid |
| SMILES | CNC(=O)CCCC(=O)C(=O)O |
| InChI | InChI=1S/C7H11NO4/c1-8-6(10)4-2-3-5(9)7(11)12/h2-4H2,1H3,(H,8,10)(H,11,12) |
| InChIKey | ASJVISUWUQETSC-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.17 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|