C17H31NO4 — CID 177193641
N-ethyl-2-[2-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropoxy]ethoxy]ethoxy]ethanamine (PubChem CID 177193641) has the molecular formula C17H31NO4 and a molecular weight of 313.44 g/mol. Its IUPAC name is N-ethyl-2-[2-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropoxy]ethoxy]ethoxy]ethanamine.
| Compound Name | N-ethyl-2-[2-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| PubChem CID | 177193641 |
| Molecular Formula | C17H31NO4 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.23 |
| IUPAC Name | N-ethyl-2-[2-[2-[3-[(3E)-hexa-1,3,5-trien-3-yl]oxypropoxy]ethoxy]ethoxy]ethanamine |
| SMILES | C=C/C=C(\C=C)OCCCOCCOCCOCCNCC |
| InChI | InChI=1S/C17H31NO4/c1-4-8-17(5-2)22-11-7-10-19-13-15-21-16-14-20-12-9-18-6-3/h4-5,8,18H,1-2,6-7,9-16H2,3H3/b17-8+ |
| InChIKey | VARISYZXVQNINY-CAOOACKPSA-N |
| XLogP | 2.31 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|