C11H20NO+ — CID 171492309
2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl-trimethylazanium (PubChem CID 171492309) has the molecular formula C11H20NO+ and a molecular weight of 182.29 g/mol. Its IUPAC name is 2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl-trimethylazanium.
| Compound Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl-trimethylazanium |
|---|---|
| PubChem CID | 171492309 |
| Molecular Formula | C11H20NO+ |
| Molecular Weight | 182.29 g/mol |
| Exact Mass | 182.15 |
| IUPAC Name | 2-[(3E)-hexa-1,3,5-trien-3-yl]oxyethyl-trimethylazanium |
| SMILES | C=C/C=C(\C=C)OCC[N+](C)(C)C |
| InChI | InChI=1S/C11H20NO/c1-6-8-11(7-2)13-10-9-12(3,4)5/h6-8H,1-2,9-10H2,3-5H3/q+1/b11-8+ |
| InChIKey | TWMBOKOWKFOZAD-DHZHZOJOSA-N |
| XLogP | 1.97 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.29 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|