C8H20N2O6S — CID 172833896
azanium;trimethyl(2-prop-2-enoyloxyethyl)azanium;sulfate (PubChem CID 172833896) has the molecular formula C8H20N2O6S and a molecular weight of 272.32 g/mol. Its IUPAC name is azanium;trimethyl(2-prop-2-enoyloxyethyl)azanium;sulfate.
| Compound Name | azanium;trimethyl(2-prop-2-enoyloxyethyl)azanium;sulfate |
|---|---|
| PubChem CID | 172833896 |
| Molecular Formula | C8H20N2O6S |
| Molecular Weight | 272.32 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | azanium;trimethyl(2-prop-2-enoyloxyethyl)azanium;sulfate |
| SMILES | C=CC(=O)OCC[N+](C)(C)C.O=S(=O)([O-])[O-].[NH4+] |
| InChI | InChI=1S/C8H16NO2.H3N.H2O4S/c1-5-8(10)11-7-6-9(2,3)4;;1-5(2,3)4/h5H,1,6-7H2,2-4H3;1H3;(H2,1,2,3,4)/q+1;;/p-1 |
| InChIKey | VWSSCZRELIVLAQ-UHFFFAOYSA-M |
| XLogP | -0.54 |
| TPSA | 143.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.32 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|