C11H19NO — CID 143714331
(2Z,4Z)-4-(3-methoxypropyl)hepta-2,4,6-trien-1-amine (PubChem CID 143714331) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is (2Z,4Z)-4-(3-methoxypropyl)hepta-2,4,6-trien-1-amine.
| Compound Name | (2Z,4Z)-4-(3-methoxypropyl)hepta-2,4,6-trien-1-amine |
|---|---|
| PubChem CID | 143714331 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | (2Z,4Z)-4-(3-methoxypropyl)hepta-2,4,6-trien-1-amine |
| SMILES | C=C/C=C(\C=C/CN)CCCOC |
| InChI | InChI=1S/C11H19NO/c1-3-6-11(7-4-9-12)8-5-10-13-2/h3-4,6-7H,1,5,8-10,12H2,2H3/b7-4-,11-6+ |
| InChIKey | ZNJWOMUAENTWKF-MBHGMHKNSA-N |
| XLogP | 2.04 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|