C14H24O2S — CID 88890747
2-[(3Z,5E)-5-(3-methoxypropyl)octa-3,5,7-trien-4-yl]sulfanylethanol (PubChem CID 88890747) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is 2-[(3Z,5E)-5-(3-methoxypropyl)octa-3,5,7-trien-4-yl]sulfanylethanol.
| Compound Name | 2-[(3Z,5E)-5-(3-methoxypropyl)octa-3,5,7-trien-4-yl]sulfanylethanol |
|---|---|
| PubChem CID | 88890747 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | 2-[(3Z,5E)-5-(3-methoxypropyl)octa-3,5,7-trien-4-yl]sulfanylethanol |
| SMILES | C=C/C=C(CCCOC)/C(=C/CC)SCCO |
| InChI | InChI=1S/C14H24O2S/c1-4-7-13(9-6-11-16-3)14(8-5-2)17-12-10-15/h4,7-8,15H,1,5-6,9-12H2,2-3H3/b13-7+,14-8- |
| InChIKey | FHBBRCXQXVRRIS-GUZOQHLSSA-N |
| XLogP | 3.54 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|