C9H12FI — CID 89277359
(3E,5E)-5-fluoro-4-(iodomethyl)octa-1,3,5-triene (PubChem CID 89277359) has the molecular formula C9H12FI and a molecular weight of 266.10 g/mol. Its IUPAC name is (3E,5E)-5-fluoro-4-(iodomethyl)octa-1,3,5-triene.
| Compound Name | (3E,5E)-5-fluoro-4-(iodomethyl)octa-1,3,5-triene |
|---|---|
| PubChem CID | 89277359 |
| Molecular Formula | C9H12FI |
| Molecular Weight | 266.10 g/mol |
| Exact Mass | 266.00 |
| IUPAC Name | (3E,5E)-5-fluoro-4-(iodomethyl)octa-1,3,5-triene |
| SMILES | C=C/C=C(CI)\C(F)=C/CC |
| InChI | InChI=1S/C9H12FI/c1-3-5-8(7-11)9(10)6-4-2/h3,5-6H,1,4,7H2,2H3/b8-5-,9-6+ |
| InChIKey | YNJSNYMYEBZJLV-LDFAFZTOSA-N |
| XLogP | 3.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.10 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|