C6H9F — CID 88586520
(3E)-4-fluorohexa-1,3-diene (PubChem CID 88586520) has the molecular formula C6H9F and a molecular weight of 100.14 g/mol. Its IUPAC name is (3E)-4-fluorohexa-1,3-diene.
| Compound Name | (3E)-4-fluorohexa-1,3-diene |
|---|---|
| PubChem CID | 88586520 |
| Molecular Formula | C6H9F |
| Molecular Weight | 100.14 g/mol |
| Exact Mass | 100.07 |
| IUPAC Name | (3E)-4-fluorohexa-1,3-diene |
| SMILES | C=C/C=C(/F)CC |
| InChI | InChI=1S/C6H9F/c1-3-5-6(7)4-2/h3,5H,1,4H2,2H3/b6-5+ |
| InChIKey | OODCSLCQVOPVTQ-AATRIKPKSA-N |
| XLogP | 2.44 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 100.14 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|