C9H16 — CID 142915962
(3E)-4-ethyl-5-methylhexa-1,3-diene (PubChem CID 142915962) has the molecular formula C9H16 and a molecular weight of 124.23 g/mol. Its IUPAC name is (3E)-4-ethyl-5-methylhexa-1,3-diene.
| Compound Name | (3E)-4-ethyl-5-methylhexa-1,3-diene |
|---|---|
| PubChem CID | 142915962 |
| Molecular Formula | C9H16 |
| Molecular Weight | 124.23 g/mol |
| Exact Mass | 124.13 |
| IUPAC Name | (3E)-4-ethyl-5-methylhexa-1,3-diene |
| SMILES | C=C/C=C(\CC)C(C)C |
| InChI | InChI=1S/C9H16/c1-5-7-9(6-2)8(3)4/h5,7-8H,1,6H2,2-4H3/b9-7+ |
| InChIKey | JYQDWKQFNMSSAX-VQHVLOKHSA-N |
| XLogP | 3.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 124.23 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|