C22H38 — CID 144667400
(3Z)-4-ethyl-5-methylocta-1,3-diene;(3Z)-3-ethyl-4-propan-2-ylhexa-1,3,5-triene (PubChem CID 144667400) has the molecular formula C22H38 and a molecular weight of 302.55 g/mol. Its IUPAC name is (3Z)-4-ethyl-5-methylocta-1,3-diene;(3Z)-3-ethyl-4-propan-2-ylhexa-1,3,5-triene.
| Compound Name | (3Z)-4-ethyl-5-methylocta-1,3-diene;(3Z)-3-ethyl-4-propan-2-ylhexa-1,3,5-triene |
|---|---|
| PubChem CID | 144667400 |
| Molecular Formula | C22H38 |
| Molecular Weight | 302.55 g/mol |
| Exact Mass | 302.30 |
| IUPAC Name | (3Z)-4-ethyl-5-methylocta-1,3-diene;(3Z)-3-ethyl-4-propan-2-ylhexa-1,3,5-triene |
| SMILES | C=C/C(CC)=C(\C=C)C(C)C.C=C/C=C(/CC)C(C)CCC |
| InChI | InChI=1S/C11H18.C11H20/c1-6-10(7-2)11(8-3)9(4)5;1-5-8-10(4)11(7-3)9-6-2/h6,8-9H,1,3,7H2,2,4-5H3;6,9-10H,2,5,7-8H2,1,3-4H3/b11-10-;11-9- |
| InChIKey | MVZMDCZJUIWELJ-MBLAEGESSA-N |
| XLogP | 7.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.55 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|