C12H21N — CID 137390509
(3Z,5Z)-3-ethyl-5-propan-2-ylhepta-1,3,5-trien-4-amine (PubChem CID 137390509) has the molecular formula C12H21N and a molecular weight of 179.31 g/mol. Its IUPAC name is (3Z,5Z)-3-ethyl-5-propan-2-ylhepta-1,3,5-trien-4-amine.
| Compound Name | (3Z,5Z)-3-ethyl-5-propan-2-ylhepta-1,3,5-trien-4-amine |
|---|---|
| PubChem CID | 137390509 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | (3Z,5Z)-3-ethyl-5-propan-2-ylhepta-1,3,5-trien-4-amine |
| SMILES | C=C/C(CC)=C(N)/C(=C\C)C(C)C |
| InChI | InChI=1S/C12H21N/c1-6-10(7-2)12(13)11(8-3)9(4)5/h6,8-9H,1,7,13H2,2-5H3/b11-8-,12-10+ |
| InChIKey | IOGYDZVUGKVSMN-XNGMQHMOSA-N |
| XLogP | 3.40 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|